About sodium;2-aminoethanethiol;4-methylbenzenesulfonate
sodium;2-aminoethanethiol;4-methylbenzenesulfonate (PubChem CID 175141667) has the molecular formula C9H14NNaO3S2
and a molecular weight of 271.34 g/mol. Its IUPAC name is sodium;2-aminoethanethiol;4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | sodium;2-aminoethanethiol;4-methylbenzenesulfonate |
| PubChem CID | 175141667 |
| Molecular Formula | C9H14NNaO3S2 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | sodium;2-aminoethanethiol;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.NCCS.[Na+] |
| InChI | InChI=1S/C7H8O3S.C2H7NS.Na/c1-6-2-4-7(5-3-6)11(8,9)10;3-1-2-4;/h2-5H,1H3,(H,8,9,10);4H,1-3H2;/q;;+1/p-1 |
| InChIKey | URWRDJHCGWPJEL-UHFFFAOYSA-M |
| XLogP | -2.22 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-aminoethanethiol;4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-aminoethanethiol;4-methylbenzenesulfonate?
The IUPAC name of sodium;2-aminoethanethiol;4-methylbenzenesulfonate (CID 175141667) is sodium;2-aminoethanethiol;4-methylbenzenesulfonate.
What is the SMILES notation for sodium;2-aminoethanethiol;4-methylbenzenesulfonate?
The canonical SMILES for sodium;2-aminoethanethiol;4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)[O-])cc1.NCCS.[Na+].
What is the InChIKey of sodium;2-aminoethanethiol;4-methylbenzenesulfonate?
The InChIKey is URWRDJHCGWPJEL-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O3S.C2H7NS.Na/c1-6-2-4-7(5-3-6)11(8,9)10;3-1-2-4;/h2-5H,1H3,(H,8,9,10);4H,1-3H2;/q;;+1/p-1.
What are the key properties of sodium;2-aminoethanethiol;4-methylbenzenesulfonate?
sodium;2-aminoethanethiol;4-methylbenzenesulfonate has a molecular weight of 271.34 g/mol, XLogP of -2.22, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-aminoethanethiol;4-methylbenzenesulfonate is sourced from PubChem (CID 175141667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).