C10H13FNO3S- — CID 22936757
2-fluorocyclopropan-1-amine;4-methylbenzenesulfonate (PubChem CID 22936757) has the molecular formula C10H13FNO3S- and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-fluorocyclopropan-1-amine;4-methylbenzenesulfonate.
| Compound Name | 2-fluorocyclopropan-1-amine;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22936757 |
| Molecular Formula | C10H13FNO3S- |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-fluorocyclopropan-1-amine;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.NC1CC1F |
| InChI | InChI=1S/C7H8O3S.C3H6FN/c1-6-2-4-7(5-3-6)11(8,9)10;4-2-1-3(2)5/h2-5H,1H3,(H,8,9,10);2-3H,1,5H2/p-1 |
| InChIKey | XUWZMHVPMZXIRU-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|