C13H21NO4S — CID 142626993
2,6-dimethylmorpholin-4-ium;4-methylbenzenesulfonate (PubChem CID 142626993) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2,6-dimethylmorpholin-4-ium;4-methylbenzenesulfonate.
| Compound Name | 2,6-dimethylmorpholin-4-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 142626993 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2,6-dimethylmorpholin-4-ium;4-methylbenzenesulfonate |
| SMILES | CC1C[NH2+]CC(C)O1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C6H13NO/c1-6-2-4-7(5-3-6)11(8,9)10;1-5-3-7-4-6(2)8-5/h2-5H,1H3,(H,8,9,10);5-7H,3-4H2,1-2H3 |
| InChIKey | RSCNKSMALSYWMS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|