C10H14F2O5S — CID 175571921
2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid (PubChem CID 175571921) has the molecular formula C10H14F2O5S and a molecular weight of 284.28 g/mol. Its IUPAC name is 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid.
| Compound Name | 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175571921 |
| Molecular Formula | C10H14F2O5S |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.OCC(F)(F)CO |
| InChI | InChI=1S/C7H8O3S.C3H6F2O2/c1-6-2-4-7(5-3-6)11(8,9)10;4-3(5,1-6)2-7/h2-5H,1H3,(H,8,9,10);6-7H,1-2H2 |
| InChIKey | NJMHISOGVFJCKT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|