2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid

C10H14F2O5S — CID 175571921

IUPAC2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid
SMILESCc1ccc(S(=O)(=O)O)cc1.OCC(F)(F)CO
InChIInChI=1S/C7H8O3S.C3H6F2O2/c1-6-2-4-7(5-3-6)11(8,9)10;4-3(5,1-6)2-7/h2-5H,1H3,(H,8,9,10);6-7H,1-2H2
InChIKeyNJMHISOGVFJCKT-UHFFFAOYSA-N
MW284.28 g/mol
LogP0.85
Rot. Bonds3

About 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid

2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid (PubChem CID 175571921) has the molecular formula C10H14F2O5S and a molecular weight of 284.28 g/mol. Its IUPAC name is 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid.

Molecular Properties

Compound Name2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid
PubChem CID175571921
Molecular FormulaC10H14F2O5S
Molecular Weight284.28 g/mol
Exact Mass284.05
IUPAC Name2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid
SMILESCc1ccc(S(=O)(=O)O)cc1.OCC(F)(F)CO
InChIInChI=1S/C7H8O3S.C3H6F2O2/c1-6-2-4-7(5-3-6)11(8,9)10;4-3(5,1-6)2-7/h2-5H,1H3,(H,8,9,10);6-7H,1-2H2
InChIKeyNJMHISOGVFJCKT-UHFFFAOYSA-N
XLogP0.85
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.28
LogP ≤ 50.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid?
The IUPAC name of 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid (CID 175571921) is 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid.
What is the SMILES notation for 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid?
The canonical SMILES for 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.OCC(F)(F)CO.
What is the InChIKey of 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid?
The InChIKey is NJMHISOGVFJCKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C3H6F2O2/c1-6-2-4-7(5-3-6)11(8,9)10;4-3(5,1-6)2-7/h2-5H,1H3,(H,8,9,10);6-7H,1-2H2.
What are the key properties of 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid?
2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid has a molecular weight of 284.28 g/mol, XLogP of 0.85, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoropropane-1,3-diol;4-methylbenzenesulfonic acid is sourced from PubChem (CID 175571921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).