About ethene;bis(4-methylbenzenesulfonic acid)
ethene;bis(4-methylbenzenesulfonic acid) (PubChem CID 175141625) has the molecular formula C16H20O6S2
and a molecular weight of 372.46 g/mol. Its IUPAC name is ethene;bis(4-methylbenzenesulfonic acid).
Molecular Properties
| Compound Name | ethene;bis(4-methylbenzenesulfonic acid) |
| PubChem CID | 175141625 |
| Molecular Formula | C16H20O6S2 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | ethene;bis(4-methylbenzenesulfonic acid) |
| SMILES | C=C.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/2C7H8O3S.C2H4/c2*1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2*2-5H,1H3,(H,8,9,10);1-2H2 |
| InChIKey | GJQADFUMALVKFT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethene;bis(4-methylbenzenesulfonic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;bis(4-methylbenzenesulfonic acid)?
The IUPAC name of ethene;bis(4-methylbenzenesulfonic acid) (CID 175141625) is ethene;bis(4-methylbenzenesulfonic acid).
What is the SMILES notation for ethene;bis(4-methylbenzenesulfonic acid)?
The canonical SMILES for ethene;bis(4-methylbenzenesulfonic acid) is C=C.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of ethene;bis(4-methylbenzenesulfonic acid)?
The InChIKey is GJQADFUMALVKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8O3S.C2H4/c2*1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2*2-5H,1H3,(H,8,9,10);1-2H2.
What are the key properties of ethene;bis(4-methylbenzenesulfonic acid)?
ethene;bis(4-methylbenzenesulfonic acid) has a molecular weight of 372.46 g/mol, XLogP of 3.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;bis(4-methylbenzenesulfonic acid) is sourced from PubChem (CID 175141625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).