About sodium;4-methylbenzenesulfonic acid;azide
sodium;4-methylbenzenesulfonic acid;azide (PubChem CID 172780607) has the molecular formula C7H8N3NaO3S
and a molecular weight of 237.22 g/mol. Its IUPAC name is sodium;4-methylbenzenesulfonic acid;azide.
Molecular Properties
| Compound Name | sodium;4-methylbenzenesulfonic acid;azide |
| PubChem CID | 172780607 |
| Molecular Formula | C7H8N3NaO3S |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | sodium;4-methylbenzenesulfonic acid;azide |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.[N-]=[N+]=[N-].[Na+] |
| InChI | InChI=1S/C7H8O3S.N3.Na/c1-6-2-4-7(5-3-6)11(8,9)10;1-3-2;/h2-5H,1H3,(H,8,9,10);;/q;-1;+1 |
| InChIKey | OEWIEXAZRGAZST-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-methylbenzenesulfonic acid;azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-methylbenzenesulfonic acid;azide?
The IUPAC name of sodium;4-methylbenzenesulfonic acid;azide (CID 172780607) is sodium;4-methylbenzenesulfonic acid;azide.
What is the SMILES notation for sodium;4-methylbenzenesulfonic acid;azide?
The canonical SMILES for sodium;4-methylbenzenesulfonic acid;azide is Cc1ccc(S(=O)(=O)O)cc1.[N-]=[N+]=[N-].[Na+].
What is the InChIKey of sodium;4-methylbenzenesulfonic acid;azide?
The InChIKey is OEWIEXAZRGAZST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.N3.Na/c1-6-2-4-7(5-3-6)11(8,9)10;1-3-2;/h2-5H,1H3,(H,8,9,10);;/q;-1;+1.
What are the key properties of sodium;4-methylbenzenesulfonic acid;azide?
sodium;4-methylbenzenesulfonic acid;azide has a molecular weight of 237.22 g/mol, XLogP of -0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-methylbenzenesulfonic acid;azide is sourced from PubChem (CID 172780607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).