About azane;4-methylbenzenesulfonic acid;hydrate
azane;4-methylbenzenesulfonic acid;hydrate (PubChem CID 87973171) has the molecular formula C7H13NO4S
and a molecular weight of 207.25 g/mol. Its IUPAC name is azane;4-methylbenzenesulfonic acid;hydrate.
Molecular Properties
| Compound Name | azane;4-methylbenzenesulfonic acid;hydrate |
| PubChem CID | 87973171 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | azane;4-methylbenzenesulfonic acid;hydrate |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N.O |
| InChI | InChI=1S/C7H8O3S.H3N.H2O/c1-6-2-4-7(5-3-6)11(8,9)10;;/h2-5H,1H3,(H,8,9,10);1H3;1H2 |
| InChIKey | AIOBKJSZCKJHOA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;4-methylbenzenesulfonic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-methylbenzenesulfonic acid;hydrate?
The IUPAC name of azane;4-methylbenzenesulfonic acid;hydrate (CID 87973171) is azane;4-methylbenzenesulfonic acid;hydrate.
What is the SMILES notation for azane;4-methylbenzenesulfonic acid;hydrate?
The canonical SMILES for azane;4-methylbenzenesulfonic acid;hydrate is Cc1ccc(S(=O)(=O)O)cc1.N.O.
What is the InChIKey of azane;4-methylbenzenesulfonic acid;hydrate?
The InChIKey is AIOBKJSZCKJHOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.H3N.H2O/c1-6-2-4-7(5-3-6)11(8,9)10;;/h2-5H,1H3,(H,8,9,10);1H3;1H2.
What are the key properties of azane;4-methylbenzenesulfonic acid;hydrate?
azane;4-methylbenzenesulfonic acid;hydrate has a molecular weight of 207.25 g/mol, XLogP of 0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-methylbenzenesulfonic acid;hydrate is sourced from PubChem (CID 87973171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).