About (125I)iodomethane;4-methylbenzenesulfonic acid
(125I)iodomethane;4-methylbenzenesulfonic acid (PubChem CID 158752448) has the molecular formula C8H11IO3S
and a molecular weight of 312.14 g/mol. Its IUPAC name is (125I)iodomethane;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | (125I)iodomethane;4-methylbenzenesulfonic acid |
| PubChem CID | 158752448 |
| Molecular Formula | C8H11IO3S |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | (125I)iodomethane;4-methylbenzenesulfonic acid |
| SMILES | C[125I].Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.CH3I/c1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2-5H,1H3,(H,8,9,10);1H3/i;2-2 |
| InChIKey | SQVRJHRGJSUHIM-BGVKGDKFSA-N |
| XLogP | 2.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (125I)iodomethane;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (125I)iodomethane;4-methylbenzenesulfonic acid?
The IUPAC name of (125I)iodomethane;4-methylbenzenesulfonic acid (CID 158752448) is (125I)iodomethane;4-methylbenzenesulfonic acid.
What is the SMILES notation for (125I)iodomethane;4-methylbenzenesulfonic acid?
The canonical SMILES for (125I)iodomethane;4-methylbenzenesulfonic acid is C[125I].Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of (125I)iodomethane;4-methylbenzenesulfonic acid?
The InChIKey is SQVRJHRGJSUHIM-BGVKGDKFSA-N. The full InChI is InChI=1S/C7H8O3S.CH3I/c1-6-2-4-7(5-3-6)11(8,9)10;1-2/h2-5H,1H3,(H,8,9,10);1H3/i;2-2.
What are the key properties of (125I)iodomethane;4-methylbenzenesulfonic acid?
(125I)iodomethane;4-methylbenzenesulfonic acid has a molecular weight of 312.14 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (125I)iodomethane;4-methylbenzenesulfonic acid is sourced from PubChem (CID 158752448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).