About dichloromethane;4-methylbenzenesulfonic acid
dichloromethane;4-methylbenzenesulfonic acid (PubChem CID 158574203) has the molecular formula C8H10Cl2O3S
and a molecular weight of 257.14 g/mol. Its IUPAC name is dichloromethane;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | dichloromethane;4-methylbenzenesulfonic acid |
| PubChem CID | 158574203 |
| Molecular Formula | C8H10Cl2O3S |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | dichloromethane;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.ClCCl |
| InChI | InChI=1S/C7H8O3S.CH2Cl2/c1-6-2-4-7(5-3-6)11(8,9)10;2-1-3/h2-5H,1H3,(H,8,9,10);1H2 |
| InChIKey | HSLOBCFVARKLLN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;4-methylbenzenesulfonic acid?
The IUPAC name of dichloromethane;4-methylbenzenesulfonic acid (CID 158574203) is dichloromethane;4-methylbenzenesulfonic acid.
What is the SMILES notation for dichloromethane;4-methylbenzenesulfonic acid?
The canonical SMILES for dichloromethane;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.ClCCl.
What is the InChIKey of dichloromethane;4-methylbenzenesulfonic acid?
The InChIKey is HSLOBCFVARKLLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.CH2Cl2/c1-6-2-4-7(5-3-6)11(8,9)10;2-1-3/h2-5H,1H3,(H,8,9,10);1H2.
What are the key properties of dichloromethane;4-methylbenzenesulfonic acid?
dichloromethane;4-methylbenzenesulfonic acid has a molecular weight of 257.14 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;4-methylbenzenesulfonic acid is sourced from PubChem (CID 158574203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).