C17H24O6S4 — CID 137365057
bis(4-methylbenzenesulfonic acid);propane-1,3-dithiol (PubChem CID 137365057) has the molecular formula C17H24O6S4 and a molecular weight of 452.64 g/mol. Its IUPAC name is bis(4-methylbenzenesulfonic acid);propane-1,3-dithiol.
| Compound Name | bis(4-methylbenzenesulfonic acid);propane-1,3-dithiol |
|---|---|
| PubChem CID | 137365057 |
| Molecular Formula | C17H24O6S4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | bis(4-methylbenzenesulfonic acid);propane-1,3-dithiol |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.SCCCS |
| InChI | InChI=1S/2C7H8O3S.C3H8S2/c2*1-6-2-4-7(5-3-6)11(8,9)10;4-2-1-3-5/h2*2-5H,1H3,(H,8,9,10);4-5H,1-3H2 |
| InChIKey | ZGWQQNXFVJBDQX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|