About azidoethane;4-methylbenzenesulfonic acid
azidoethane;4-methylbenzenesulfonic acid (PubChem CID 175041595) has the molecular formula C9H13N3O3S
and a molecular weight of 243.29 g/mol. Its IUPAC name is azidoethane;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | azidoethane;4-methylbenzenesulfonic acid |
| PubChem CID | 175041595 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | azidoethane;4-methylbenzenesulfonic acid |
| SMILES | CCN=[N+]=[N-].Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C2H5N3/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-5-3/h2-5H,1H3,(H,8,9,10);2H2,1H3 |
| InChIKey | ZBHSPNJNINGVGK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azidoethane;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidoethane;4-methylbenzenesulfonic acid?
The IUPAC name of azidoethane;4-methylbenzenesulfonic acid (CID 175041595) is azidoethane;4-methylbenzenesulfonic acid.
What is the SMILES notation for azidoethane;4-methylbenzenesulfonic acid?
The canonical SMILES for azidoethane;4-methylbenzenesulfonic acid is CCN=[N+]=[N-].Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of azidoethane;4-methylbenzenesulfonic acid?
The InChIKey is ZBHSPNJNINGVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C2H5N3/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-5-3/h2-5H,1H3,(H,8,9,10);2H2,1H3.
What are the key properties of azidoethane;4-methylbenzenesulfonic acid?
azidoethane;4-methylbenzenesulfonic acid has a molecular weight of 243.29 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azidoethane;4-methylbenzenesulfonic acid is sourced from PubChem (CID 175041595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).