C14H14MnO3S- — CID 101048548
CID 101048548 (PubChem CID 101048548) has the molecular formula C14H14MnO3S- and a molecular weight of 317.27 g/mol.
| Compound Name | CID 101048548 |
|---|---|
| PubChem CID | 101048548 |
| Molecular Formula | C14H14MnO3S- |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | — |
| SMILES | C=C1[CH]C=CC=C1.Cc1ccc(S(=O)(=O)[O-])cc1.[Mn] |
| InChI | InChI=1S/C7H8O3S.C7H7.Mn/c1-6-2-4-7(5-3-6)11(8,9)10;1-7-5-3-2-4-6-7;/h2-5H,1H3,(H,8,9,10);2-6H,1H2;/p-1 |
| InChIKey | QNDJWPPMGUNWNC-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|