C12H21NO4S — CID 175547526
1-hydroxyethyl(trimethyl)azanium;4-methylbenzenesulfonate (PubChem CID 175547526) has the molecular formula C12H21NO4S and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-hydroxyethyl(trimethyl)azanium;4-methylbenzenesulfonate.
| Compound Name | 1-hydroxyethyl(trimethyl)azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175547526 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-hydroxyethyl(trimethyl)azanium;4-methylbenzenesulfonate |
| SMILES | CC(O)[N+](C)(C)C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C5H14NO/c1-6-2-4-7(5-3-6)11(8,9)10;1-5(7)6(2,3)4/h2-5H,1H3,(H,8,9,10);5,7H,1-4H3/q;+1/p-1 |
| InChIKey | KJPNAECOKJXSSP-UHFFFAOYSA-M |
| XLogP | 0.93 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|