C12H22N2O4S — CID 139767458
amino-(1-hydroxypropyl)-dimethylazanium;4-methylbenzenesulfonate (PubChem CID 139767458) has the molecular formula C12H22N2O4S and a molecular weight of 290.39 g/mol. Its IUPAC name is amino-(1-hydroxypropyl)-dimethylazanium;4-methylbenzenesulfonate.
| Compound Name | amino-(1-hydroxypropyl)-dimethylazanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139767458 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | amino-(1-hydroxypropyl)-dimethylazanium;4-methylbenzenesulfonate |
| SMILES | CCC(O)[N+](C)(C)N.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C5H15N2O/c1-6-2-4-7(5-3-6)11(8,9)10;1-4-5(8)7(2,3)6/h2-5H,1H3,(H,8,9,10);5,8H,4,6H2,1-3H3/q;+1/p-1 |
| InChIKey | XXCKKYMBJJXZNE-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|