C17H31NO3S — CID 71445519
4-methylbenzenesulfonate;methyl(tripropyl)azanium (PubChem CID 71445519) has the molecular formula C17H31NO3S and a molecular weight of 329.51 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;methyl(tripropyl)azanium.
| Compound Name | 4-methylbenzenesulfonate;methyl(tripropyl)azanium |
|---|---|
| PubChem CID | 71445519 |
| Molecular Formula | C17H31NO3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 4-methylbenzenesulfonate;methyl(tripropyl)azanium |
| SMILES | CCC[N+](C)(CCC)CCC.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H24N.C7H8O3S/c1-5-8-11(4,9-6-2)10-7-3;1-6-2-4-7(5-3-6)11(8,9)10/h5-10H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | BTGLUENPRUFOMM-UHFFFAOYSA-M |
| XLogP | 3.56 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|