C22H40BrNO3S — CID 139956000
3-bromopropyl-hexyl-methyl-pentylazanium;4-methylbenzenesulfonate (PubChem CID 139956000) has the molecular formula C22H40BrNO3S and a molecular weight of 478.54 g/mol. Its IUPAC name is 3-bromopropyl-hexyl-methyl-pentylazanium;4-methylbenzenesulfonate.
| Compound Name | 3-bromopropyl-hexyl-methyl-pentylazanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139956000 |
| Molecular Formula | C22H40BrNO3S |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-bromopropyl-hexyl-methyl-pentylazanium;4-methylbenzenesulfonate |
| SMILES | CCCCCC[N+](C)(CCCBr)CCCCC.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H33BrN.C7H8O3S/c1-4-6-8-10-14-17(3,15-11-12-16)13-9-7-5-2;1-6-2-4-7(5-3-6)11(8,9)10/h4-15H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | FKDGBMPLIBKAFZ-UHFFFAOYSA-M |
| XLogP | 5.89 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|