C22H41NO4S — CID 139956105
hexyl-(3-hydroxypropyl)-methyl-pentylazanium;4-methylbenzenesulfonate (PubChem CID 139956105) has the molecular formula C22H41NO4S and a molecular weight of 415.64 g/mol. Its IUPAC name is hexyl-(3-hydroxypropyl)-methyl-pentylazanium;4-methylbenzenesulfonate.
| Compound Name | hexyl-(3-hydroxypropyl)-methyl-pentylazanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139956105 |
| Molecular Formula | C22H41NO4S |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | hexyl-(3-hydroxypropyl)-methyl-pentylazanium;4-methylbenzenesulfonate |
| SMILES | CCCCCC[N+](C)(CCCO)CCCCC.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H34NO.C7H8O3S/c1-4-6-8-10-13-16(3,14-11-15-17)12-9-7-5-2;1-6-2-4-7(5-3-6)11(8,9)10/h17H,4-15H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | BQIGOHQVFSMOGA-UHFFFAOYSA-M |
| XLogP | 4.49 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|