About bis(1-ethyl-3-methylimidazol-3-ium);sulfate
bis(1-ethyl-3-methylimidazol-3-ium);sulfate (PubChem CID 87371593) has the molecular formula C12H22N4O4S
and a molecular weight of 318.40 g/mol. Its IUPAC name is bis(1-ethyl-3-methylimidazol-3-ium);sulfate.
Molecular Properties
| Compound Name | bis(1-ethyl-3-methylimidazol-3-ium);sulfate |
| PubChem CID | 87371593 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | bis(1-ethyl-3-methylimidazol-3-ium);sulfate |
| SMILES | CCn1cc[n+](C)c1.CCn1cc[n+](C)c1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C6H11N2.H2O4S/c2*1-3-8-5-4-7(2)6-8;1-5(2,3)4/h2*4-6H,3H2,1-2H3;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | JRZXASDTNSFJBR-UHFFFAOYSA-L |
| XLogP | -0.67 |
| TPSA | 97.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(1-ethyl-3-methylimidazol-3-ium);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-ethyl-3-methylimidazol-3-ium);sulfate?
The IUPAC name of bis(1-ethyl-3-methylimidazol-3-ium);sulfate (CID 87371593) is bis(1-ethyl-3-methylimidazol-3-ium);sulfate.
What is the SMILES notation for bis(1-ethyl-3-methylimidazol-3-ium);sulfate?
The canonical SMILES for bis(1-ethyl-3-methylimidazol-3-ium);sulfate is CCn1cc[n+](C)c1.CCn1cc[n+](C)c1.O=S(=O)([O-])[O-].
What is the InChIKey of bis(1-ethyl-3-methylimidazol-3-ium);sulfate?
The InChIKey is JRZXASDTNSFJBR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H11N2.H2O4S/c2*1-3-8-5-4-7(2)6-8;1-5(2,3)4/h2*4-6H,3H2,1-2H3;(H2,1,2,3,4)/q2*+1;/p-2.
What are the key properties of bis(1-ethyl-3-methylimidazol-3-ium);sulfate?
bis(1-ethyl-3-methylimidazol-3-ium);sulfate has a molecular weight of 318.40 g/mol, XLogP of -0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-ethyl-3-methylimidazol-3-ium);sulfate is sourced from PubChem (CID 87371593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).