About 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide
1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide (PubChem CID 160555580) has the molecular formula C6H12N2O5S2
and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide.
Molecular Properties
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide |
| PubChem CID | 160555580 |
| Molecular Formula | C6H12N2O5S2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide |
| SMILES | CCn1cc[n+](C)c1.O=S.O=S(=O)([O-])O |
| InChI | InChI=1S/C6H11N2.H2O4S.OS/c1-3-8-5-4-7(2)6-8;1-5(2,3)4;1-2/h4-6H,3H2,1-2H3;(H2,1,2,3,4);/q+1;;/p-1 |
| InChIKey | AIYYCAQNIOTKFU-UHFFFAOYSA-M |
| XLogP | -1.00 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide?
The IUPAC name of 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide (CID 160555580) is 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide.
What is the SMILES notation for 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide?
The canonical SMILES for 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide is CCn1cc[n+](C)c1.O=S.O=S(=O)([O-])O.
What is the InChIKey of 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide?
The InChIKey is AIYYCAQNIOTKFU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11N2.H2O4S.OS/c1-3-8-5-4-7(2)6-8;1-5(2,3)4;1-2/h4-6H,3H2,1-2H3;(H2,1,2,3,4);/q+1;;/p-1.
What are the key properties of 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide?
1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide has a molecular weight of 256.30 g/mol, XLogP of -1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylimidazol-3-ium;hydrogen sulfate;sulfur monoxide is sourced from PubChem (CID 160555580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).