C8H17N2O6S+ — CID 139449922
acetic acid;1-ethyl-3-methylimidazol-3-ium;sulfuric acid (PubChem CID 139449922) has the molecular formula C8H17N2O6S+ and a molecular weight of 269.30 g/mol. Its IUPAC name is acetic acid;1-ethyl-3-methylimidazol-3-ium;sulfuric acid.
| Compound Name | acetic acid;1-ethyl-3-methylimidazol-3-ium;sulfuric acid |
|---|---|
| PubChem CID | 139449922 |
| Molecular Formula | C8H17N2O6S+ |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | acetic acid;1-ethyl-3-methylimidazol-3-ium;sulfuric acid |
| SMILES | CC(=O)O.CCn1cc[n+](C)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C6H11N2.C2H4O2.H2O4S/c1-3-8-5-4-7(2)6-8;1-2(3)4;1-5(2,3)4/h4-6H,3H2,1-2H3;1H3,(H,3,4);(H2,1,2,3,4)/q+1;; |
| InChIKey | RXNXGSQZPHRJFW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|