C13H22N2O6 — CID 175511750
1-ethyl-3-methylimidazol-3-ium;pentanedioic acid;acetate (PubChem CID 175511750) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;pentanedioic acid;acetate.
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;pentanedioic acid;acetate |
|---|---|
| PubChem CID | 175511750 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;pentanedioic acid;acetate |
| SMILES | CC(=O)[O-].CCn1cc[n+](C)c1.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C6H11N2.C5H8O4.C2H4O2/c1-3-8-5-4-7(2)6-8;6-4(7)2-1-3-5(8)9;1-2(3)4/h4-6H,3H2,1-2H3;1-3H2,(H,6,7)(H,8,9);1H3,(H,3,4)/q+1;;/p-1 |
| InChIKey | FPRDVCWEFYSMHJ-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|