About 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate
1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate (PubChem CID 140595243) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate.
Molecular Properties
| Compound Name | 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate |
| PubChem CID | 140595243 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate |
| SMILES | CC(C)CCCCCC(=O)[O-].CCn1cc[n+](C)c1 |
| InChI | InChI=1S/C9H18O2.C6H11N2/c1-8(2)6-4-3-5-7-9(10)11;1-3-8-5-4-7(2)6-8/h8H,3-7H2,1-2H3,(H,10,11);4-6H,3H2,1-2H3/q;+1/p-1 |
| InChIKey | AKUJZQALRYMVFX-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate?
The IUPAC name of 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate (CID 140595243) is 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate.
What is the SMILES notation for 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate?
The canonical SMILES for 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate is CC(C)CCCCCC(=O)[O-].CCn1cc[n+](C)c1.
What is the InChIKey of 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate?
The InChIKey is AKUJZQALRYMVFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O2.C6H11N2/c1-8(2)6-4-3-5-7-9(10)11;1-3-8-5-4-7(2)6-8/h8H,3-7H2,1-2H3,(H,10,11);4-6H,3H2,1-2H3/q;+1/p-1.
What are the key properties of 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate?
1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate has a molecular weight of 268.40 g/mol, XLogP of 1.68, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methylimidazol-3-ium;7-methyloctanoate is sourced from PubChem (CID 140595243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).