About 1-decyl-3-methylimidazol-3-ium;tetradecanoate
1-decyl-3-methylimidazol-3-ium;tetradecanoate (PubChem CID 175540222) has the molecular formula C28H54N2O2
and a molecular weight of 450.75 g/mol. Its IUPAC name is 1-decyl-3-methylimidazol-3-ium;tetradecanoate.
Molecular Properties
| Compound Name | 1-decyl-3-methylimidazol-3-ium;tetradecanoate |
| PubChem CID | 175540222 |
| Molecular Formula | C28H54N2O2 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.42 |
| IUPAC Name | 1-decyl-3-methylimidazol-3-ium;tetradecanoate |
| SMILES | CCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCn1cc[n+](C)c1 |
| InChI | InChI=1S/C14H27N2.C14H28O2/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h12-14H,3-11H2,1-2H3;2-13H2,1H3,(H,15,16)/q+1;/p-1 |
| InChIKey | KOMNJYRIKJNLHK-UHFFFAOYSA-M |
| XLogP | 6.89 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-3-methylimidazol-3-ium;tetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-3-methylimidazol-3-ium;tetradecanoate?
The IUPAC name of 1-decyl-3-methylimidazol-3-ium;tetradecanoate (CID 175540222) is 1-decyl-3-methylimidazol-3-ium;tetradecanoate.
What is the SMILES notation for 1-decyl-3-methylimidazol-3-ium;tetradecanoate?
The canonical SMILES for 1-decyl-3-methylimidazol-3-ium;tetradecanoate is CCCCCCCCCCCCCC(=O)[O-].CCCCCCCCCCn1cc[n+](C)c1.
What is the InChIKey of 1-decyl-3-methylimidazol-3-ium;tetradecanoate?
The InChIKey is KOMNJYRIKJNLHK-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H27N2.C14H28O2/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h12-14H,3-11H2,1-2H3;2-13H2,1H3,(H,15,16)/q+1;/p-1.
What are the key properties of 1-decyl-3-methylimidazol-3-ium;tetradecanoate?
1-decyl-3-methylimidazol-3-ium;tetradecanoate has a molecular weight of 450.75 g/mol, XLogP of 6.89, 21 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-3-methylimidazol-3-ium;tetradecanoate is sourced from PubChem (CID 175540222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).