About 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite
1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite (PubChem CID 142702549) has the molecular formula C16H32N2O3S
and a molecular weight of 332.51 g/mol. Its IUPAC name is 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite.
Molecular Properties
| Compound Name | 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite |
| PubChem CID | 142702549 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite |
| SMILES | CCCCCCCCCCCCn1cc[n+](C)c1.O=S([O-])O |
| InChI | InChI=1S/C16H31N2.H2O3S/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;1-4(2)3/h14-16H,3-13H2,1-2H3;(H2,1,2,3)/q+1;/p-1 |
| InChIKey | UJOQSMQQEXNTFX-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 69.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite?
The IUPAC name of 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite (CID 142702549) is 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite.
What is the SMILES notation for 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite?
The canonical SMILES for 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite is CCCCCCCCCCCCn1cc[n+](C)c1.O=S([O-])O.
What is the InChIKey of 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite?
The InChIKey is UJOQSMQQEXNTFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H31N2.H2O3S/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;1-4(2)3/h14-16H,3-13H2,1-2H3;(H2,1,2,3)/q+1;/p-1.
What are the key properties of 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite?
1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite has a molecular weight of 332.51 g/mol, XLogP of 3.57, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-3-methylimidazol-3-ium;hydrogen sulfite is sourced from PubChem (CID 142702549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).