C20H25F5N2O2 — CID 141403603
1-methyl-3-nonylimidazol-1-ium;2,3,4,5,6-pentafluorobenzoate (PubChem CID 141403603) has the molecular formula C20H25F5N2O2 and a molecular weight of 420.42 g/mol. Its IUPAC name is 1-methyl-3-nonylimidazol-1-ium;2,3,4,5,6-pentafluorobenzoate.
| Compound Name | 1-methyl-3-nonylimidazol-1-ium;2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 141403603 |
| Molecular Formula | C20H25F5N2O2 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-methyl-3-nonylimidazol-1-ium;2,3,4,5,6-pentafluorobenzoate |
| SMILES | CCCCCCCCCn1cc[n+](C)c1.O=C([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H25N2.C7HF5O2/c1-3-4-5-6-7-8-9-10-15-12-11-14(2)13-15;8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h11-13H,3-10H2,1-2H3;(H,13,14)/q+1;/p-1 |
| InChIKey | ADTIJBWKGHXBQM-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|