About 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate
1-methyl-3-octylimidazol-1-ium;naphthalene;acetate (PubChem CID 161296622) has the molecular formula C24H34N2O2
and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate.
Molecular Properties
| Compound Name | 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate |
| PubChem CID | 161296622 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate |
| SMILES | CC(=O)[O-].CCCCCCCCn1cc[n+](C)c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H23N2.C10H8.C2H4O2/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-2-6-10-8-4-3-7-9(10)5-1;1-2(3)4/h10-12H,3-9H2,1-2H3;1-8H;1H3,(H,3,4)/q+1;;/p-1 |
| InChIKey | CAISCEVWORUNKI-UHFFFAOYSA-M |
| XLogP | 4.27 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate?
The IUPAC name of 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate (CID 161296622) is 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate.
What is the SMILES notation for 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate?
The canonical SMILES for 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate is CC(=O)[O-].CCCCCCCCn1cc[n+](C)c1.c1ccc2ccccc2c1.
What is the InChIKey of 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate?
The InChIKey is CAISCEVWORUNKI-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H23N2.C10H8.C2H4O2/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-2-6-10-8-4-3-7-9(10)5-1;1-2(3)4/h10-12H,3-9H2,1-2H3;1-8H;1H3,(H,3,4)/q+1;;/p-1.
What are the key properties of 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate?
1-methyl-3-octylimidazol-1-ium;naphthalene;acetate has a molecular weight of 382.55 g/mol, XLogP of 4.27, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-octylimidazol-1-ium;naphthalene;acetate is sourced from PubChem (CID 161296622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).