About 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate
1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate (PubChem CID 86644516) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate |
| PubChem CID | 86644516 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate |
| SMILES | CCCCn1cc[n+](C)c1.O=C([O-])Cc1cccc2ccccc12 |
| InChI | InChI=1S/C12H10O2.C8H15N2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;1-3-4-5-10-7-6-9(2)8-10/h1-7H,8H2,(H,13,14);6-8H,3-5H2,1-2H3/q;+1/p-1 |
| InChIKey | PYOPPXFLPPTDKW-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate (CID 86644516) is 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate is CCCCn1cc[n+](C)c1.O=C([O-])Cc1cccc2ccccc12.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate?
The InChIKey is PYOPPXFLPPTDKW-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10O2.C8H15N2/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;1-3-4-5-10-7-6-9(2)8-10/h1-7H,8H2,(H,13,14);6-8H,3-5H2,1-2H3/q;+1/p-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate?
1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate has a molecular weight of 324.42 g/mol, XLogP of 2.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;2-naphthalen-1-ylacetate is sourced from PubChem (CID 86644516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).