About 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium
2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium (PubChem CID 163323136) has the molecular formula C23H36N2O3
and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium.
Molecular Properties
| Compound Name | 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium |
| PubChem CID | 163323136 |
| Molecular Formula | C23H36N2O3 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium |
| SMILES | CCCCCCCCCCCCn1cc[n+](C)c1.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C16H31N2.C7H6O3/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;8-6-4-2-1-3-5(6)7(9)10/h14-16H,3-13H2,1-2H3;1-4,8H,(H,9,10)/q+1;/p-1 |
| InChIKey | MVZONOFCGUPRRQ-UHFFFAOYSA-M |
| XLogP | 4.69 |
| TPSA | 69.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium?
The IUPAC name of 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium (CID 163323136) is 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium.
What is the SMILES notation for 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium?
The canonical SMILES for 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium is CCCCCCCCCCCCn1cc[n+](C)c1.O=C(O)c1ccccc1[O-].
What is the InChIKey of 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium?
The InChIKey is MVZONOFCGUPRRQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H31N2.C7H6O3/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;8-6-4-2-1-3-5(6)7(9)10/h14-16H,3-13H2,1-2H3;1-4,8H,(H,9,10)/q+1;/p-1.
What are the key properties of 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium?
2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium has a molecular weight of 388.55 g/mol, XLogP of 4.69, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;1-dodecyl-3-methylimidazol-3-ium is sourced from PubChem (CID 163323136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).