About 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite
1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite (PubChem CID 87096076) has the molecular formula C8H17N2O3P
and a molecular weight of 220.21 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite |
| PubChem CID | 87096076 |
| Molecular Formula | C8H17N2O3P |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite |
| SMILES | CCCCn1cc[n+](C)c1.[O-]P(O)O |
| InChI | InChI=1S/C8H15N2.H2O3P/c1-3-4-5-10-7-6-9(2)8-10;1-4(2)3/h6-8H,3-5H2,1-2H3;1-2H/q+1;-1 |
| InChIKey | DBEDBKKZBBRGDK-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite (CID 87096076) is 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite is CCCCn1cc[n+](C)c1.[O-]P(O)O.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite?
The InChIKey is DBEDBKKZBBRGDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.H2O3P/c1-3-4-5-10-7-6-9(2)8-10;1-4(2)3/h6-8H,3-5H2,1-2H3;1-2H/q+1;-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite?
1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite has a molecular weight of 220.21 g/mol, XLogP of -0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;dihydrogen phosphite is sourced from PubChem (CID 87096076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).