About 1-butyl-3-methylimidazolium hexachlorophosphate
1-butyl-3-methylimidazolium hexachlorophosphate (PubChem CID 139239305) has the molecular formula C8H15Cl6N2P
and a molecular weight of 382.91 g/mol.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazolium hexachlorophosphate |
| PubChem CID | 139239305 |
| Molecular Formula | C8H15Cl6N2P |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | — |
| SMILES | CCCCn1cc[n+](C)c1.Cl[P-](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H15N2.Cl6P/c1-3-4-5-10-7-6-9(2)8-10;1-7(2,3,4,5)6/h6-8H,3-5H2,1-2H3;/q+1;-1 |
| InChIKey | MHUBDVATLRETMH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazolium hexachlorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazolium hexachlorophosphate?
The IUPAC name of 1-butyl-3-methylimidazolium hexachlorophosphate (CID 139239305) is not available.
What is the SMILES notation for 1-butyl-3-methylimidazolium hexachlorophosphate?
The canonical SMILES for 1-butyl-3-methylimidazolium hexachlorophosphate is CCCCn1cc[n+](C)c1.Cl[P-](Cl)(Cl)(Cl)(Cl)Cl.
What is the InChIKey of 1-butyl-3-methylimidazolium hexachlorophosphate?
The InChIKey is MHUBDVATLRETMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.Cl6P/c1-3-4-5-10-7-6-9(2)8-10;1-7(2,3,4,5)6/h6-8H,3-5H2,1-2H3;/q+1;-1.
What are the key properties of 1-butyl-3-methylimidazolium hexachlorophosphate?
1-butyl-3-methylimidazolium hexachlorophosphate has a molecular weight of 382.91 g/mol, XLogP of 6.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazolium hexachlorophosphate is sourced from PubChem (CID 139239305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).