About 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate
1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate (PubChem CID 175105794) has the molecular formula C10H21F6N2OP
and a molecular weight of 330.25 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate |
| PubChem CID | 175105794 |
| Molecular Formula | C10H21F6N2OP |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate |
| SMILES | CCCCn1cc[n+](C)c1.CCO.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C8H15N2.C2H6O.F6P/c1-3-4-5-10-7-6-9(2)8-10;1-2-3;1-7(2,3,4,5)6/h6-8H,3-5H2,1-2H3;3H,2H2,1H3;/q+1;;-1 |
| InChIKey | UWMUKYFCWGOPAS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate (CID 175105794) is 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate is CCCCn1cc[n+](C)c1.CCO.F[P-](F)(F)(F)(F)F.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate?
The InChIKey is UWMUKYFCWGOPAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.C2H6O.F6P/c1-3-4-5-10-7-6-9(2)8-10;1-2-3;1-7(2,3,4,5)6/h6-8H,3-5H2,1-2H3;3H,2H2,1H3;/q+1;;-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate?
1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate has a molecular weight of 330.25 g/mol, XLogP of 4.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;ethanol;hexafluorophosphate is sourced from PubChem (CID 175105794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).