About 1-butyl-3-methylimidazol-3-ium;chloroplatinum
1-butyl-3-methylimidazol-3-ium;chloroplatinum (PubChem CID 175008486) has the molecular formula C8H15ClN2Pt+
and a molecular weight of 369.75 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;chloroplatinum.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;chloroplatinum |
| PubChem CID | 175008486 |
| Molecular Formula | C8H15ClN2Pt+ |
| Molecular Weight | 369.75 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;chloroplatinum |
| SMILES | CCCCn1cc[n+](C)c1.Cl[Pt] |
| InChI | InChI=1S/C8H15N2.ClH.Pt/c1-3-4-5-10-7-6-9(2)8-10;;/h6-8H,3-5H2,1-2H3;1H;/q+1;;+1/p-1 |
| InChIKey | BVMJGCGZECWFHJ-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.75 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;chloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;chloroplatinum?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;chloroplatinum (CID 175008486) is 1-butyl-3-methylimidazol-3-ium;chloroplatinum.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;chloroplatinum?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;chloroplatinum is CCCCn1cc[n+](C)c1.Cl[Pt].
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;chloroplatinum?
The InChIKey is BVMJGCGZECWFHJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H15N2.ClH.Pt/c1-3-4-5-10-7-6-9(2)8-10;;/h6-8H,3-5H2,1-2H3;1H;/q+1;;+1/p-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;chloroplatinum?
1-butyl-3-methylimidazol-3-ium;chloroplatinum has a molecular weight of 369.75 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;chloroplatinum is sourced from PubChem (CID 175008486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).