About 1-butyl-3-methylimidazol-3-ium;tetrahydrate
1-butyl-3-methylimidazol-3-ium;tetrahydrate (PubChem CID 175081123) has the molecular formula C8H23N2O4+
and a molecular weight of 211.28 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;tetrahydrate.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;tetrahydrate |
| PubChem CID | 175081123 |
| Molecular Formula | C8H23N2O4+ |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;tetrahydrate |
| SMILES | CCCCn1cc[n+](C)c1.O.O.O.O |
| InChI | InChI=1S/C8H15N2.4H2O/c1-3-4-5-10-7-6-9(2)8-10;;;;/h6-8H,3-5H2,1-2H3;4*1H2/q+1;;;; |
| InChIKey | NEQIQJREFGDDRB-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 134.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;tetrahydrate?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;tetrahydrate (CID 175081123) is 1-butyl-3-methylimidazol-3-ium;tetrahydrate.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;tetrahydrate?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;tetrahydrate is CCCCn1cc[n+](C)c1.O.O.O.O.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;tetrahydrate?
The InChIKey is NEQIQJREFGDDRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.4H2O/c1-3-4-5-10-7-6-9(2)8-10;;;;/h6-8H,3-5H2,1-2H3;4*1H2/q+1;;;;.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;tetrahydrate?
1-butyl-3-methylimidazol-3-ium;tetrahydrate has a molecular weight of 211.28 g/mol, XLogP of -2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;tetrahydrate is sourced from PubChem (CID 175081123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).