About 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide
1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide (PubChem CID 87139209) has the molecular formula C12H15BN6
and a molecular weight of 254.11 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide |
| PubChem CID | 87139209 |
| Molecular Formula | C12H15BN6 |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide |
| SMILES | CCCCn1cc[n+](C)c1.N#C[B-](C#N)(C#N)C#N |
| InChI | InChI=1S/C8H15N2.C4BN4/c1-3-4-5-10-7-6-9(2)8-10;6-1-5(2-7,3-8)4-9/h6-8H,3-5H2,1-2H3;/q+1;-1 |
| InChIKey | OFKIUQATOFBCQB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 103.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide (CID 87139209) is 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide is CCCCn1cc[n+](C)c1.N#C[B-](C#N)(C#N)C#N.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide?
The InChIKey is OFKIUQATOFBCQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.C4BN4/c1-3-4-5-10-7-6-9(2)8-10;6-1-5(2-7,3-8)4-9/h6-8H,3-5H2,1-2H3;/q+1;-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide?
1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide has a molecular weight of 254.11 g/mol, XLogP of 0.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;tetracyanoboranuide is sourced from PubChem (CID 87139209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).