About cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium
cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium (PubChem CID 87338806) has the molecular formula C18H32N5+
and a molecular weight of 318.49 g/mol. Its IUPAC name is cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium.
Molecular Properties
| Compound Name | cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium |
| PubChem CID | 87338806 |
| Molecular Formula | C18H32N5+ |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium |
| SMILES | CCCCCCCCCCCCn1cc[n+](C)c1.N#CNC#N |
| InChI | InChI=1S/C16H31N2.C2HN3/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;3-1-5-2-4/h14-16H,3-13H2,1-2H3;5H/q+1; |
| InChIKey | REUNGIVQDBJAGK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium?
The IUPAC name of cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium (CID 87338806) is cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium.
What is the SMILES notation for cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium?
The canonical SMILES for cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium is CCCCCCCCCCCCn1cc[n+](C)c1.N#CNC#N.
What is the InChIKey of cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium?
The InChIKey is REUNGIVQDBJAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N2.C2HN3/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;3-1-5-2-4/h14-16H,3-13H2,1-2H3;5H/q+1;.
What are the key properties of cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium?
cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium has a molecular weight of 318.49 g/mol, XLogP of 3.77, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanocyanamide;1-dodecyl-3-methylimidazol-3-ium is sourced from PubChem (CID 87338806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).