About 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane
1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane (PubChem CID 161418518) has the molecular formula C14H24BIN8+2
and a molecular weight of 442.12 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane |
| PubChem CID | 161418518 |
| Molecular Formula | C14H24BIN8+2 |
| Molecular Weight | 442.12 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane |
| SMILES | CB(C)I.CCCCn1cc[n+](C)c1.N#CNC#N.N#C[NH2+]C#N |
| InChI | InChI=1S/C8H15N2.C2H6BI.2C2HN3/c1-3-4-5-10-7-6-9(2)8-10;1-3(2)4;2*3-1-5-2-4/h6-8H,3-5H2,1-2H3;1-2H3;2*5H/q+1;;;/p+1 |
| InChIKey | VWKLWFRIBCUKSU-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.12 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane (CID 161418518) is 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane is CB(C)I.CCCCn1cc[n+](C)c1.N#CNC#N.N#C[NH2+]C#N.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane?
The InChIKey is VWKLWFRIBCUKSU-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H15N2.C2H6BI.2C2HN3/c1-3-4-5-10-7-6-9(2)8-10;1-3(2)4;2*3-1-5-2-4/h6-8H,3-5H2,1-2H3;1-2H3;2*5H/q+1;;;/p+1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane?
1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane has a molecular weight of 442.12 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;cyanocyanamide;dicyanoazanium;iodo(dimethyl)borane is sourced from PubChem (CID 161418518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).