About 1-butyl-3-methylimidazol-3-ium;urea;chloride
1-butyl-3-methylimidazol-3-ium;urea;chloride (PubChem CID 174948726) has the molecular formula C9H19ClN4O
and a molecular weight of 234.73 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;urea;chloride.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;urea;chloride |
| PubChem CID | 174948726 |
| Molecular Formula | C9H19ClN4O |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;urea;chloride |
| SMILES | CCCCn1cc[n+](C)c1.NC(N)=O.[Cl-] |
| InChI | InChI=1S/C8H15N2.CH4N2O.ClH/c1-3-4-5-10-7-6-9(2)8-10;2-1(3)4;/h6-8H,3-5H2,1-2H3;(H4,2,3,4);1H/q+1;;/p-1 |
| InChIKey | VOOVSFOATBJHTN-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;urea;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;urea;chloride?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;urea;chloride (CID 174948726) is 1-butyl-3-methylimidazol-3-ium;urea;chloride.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;urea;chloride?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;urea;chloride is CCCCn1cc[n+](C)c1.NC(N)=O.[Cl-].
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;urea;chloride?
The InChIKey is VOOVSFOATBJHTN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H15N2.CH4N2O.ClH/c1-3-4-5-10-7-6-9(2)8-10;2-1(3)4;/h6-8H,3-5H2,1-2H3;(H4,2,3,4);1H/q+1;;/p-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;urea;chloride?
1-butyl-3-methylimidazol-3-ium;urea;chloride has a molecular weight of 234.73 g/mol, XLogP of -2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;urea;chloride is sourced from PubChem (CID 174948726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).