About sodium 13-methyltetradecanoate
sodium 13-methyltetradecanoate (PubChem CID 44515571) has the molecular formula C15H29NaO2
and a molecular weight of 264.38 g/mol. Its IUPAC name is sodium 13-methyltetradecanoate.
Molecular Properties
| Compound Name | sodium 13-methyltetradecanoate |
| PubChem CID | 44515571 |
| Molecular Formula | C15H29NaO2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | sodium 13-methyltetradecanoate |
| SMILES | CC(C)CCCCCCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H30O2.Na/c1-14(2)12-10-8-6-4-3-5-7-9-11-13-15(16)17;/h14H,3-13H2,1-2H3,(H,16,17);/q;+1/p-1 |
| InChIKey | NTLZCTYUYIPTNS-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 13-methyltetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 13-methyltetradecanoate?
The IUPAC name of sodium 13-methyltetradecanoate (CID 44515571) is sodium 13-methyltetradecanoate.
What is the SMILES notation for sodium 13-methyltetradecanoate?
The canonical SMILES for sodium 13-methyltetradecanoate is CC(C)CCCCCCCCCCCC(=O)[O-].[Na+].
What is the InChIKey of sodium 13-methyltetradecanoate?
The InChIKey is NTLZCTYUYIPTNS-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H30O2.Na/c1-14(2)12-10-8-6-4-3-5-7-9-11-13-15(16)17;/h14H,3-13H2,1-2H3,(H,16,17);/q;+1/p-1.
What are the key properties of sodium 13-methyltetradecanoate?
sodium 13-methyltetradecanoate has a molecular weight of 264.38 g/mol, XLogP of 0.69, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 13-methyltetradecanoate is sourced from PubChem (CID 44515571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).