About hexylazanium;16-methylheptadecanoate
hexylazanium;16-methylheptadecanoate (PubChem CID 154824431) has the molecular formula C24H51NO2
and a molecular weight of 385.68 g/mol. Its IUPAC name is hexylazanium;16-methylheptadecanoate.
Molecular Properties
| Compound Name | hexylazanium;16-methylheptadecanoate |
| PubChem CID | 154824431 |
| Molecular Formula | C24H51NO2 |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.39 |
| IUPAC Name | hexylazanium;16-methylheptadecanoate |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)[O-].CCCCCC[NH3+] |
| InChI | InChI=1S/C18H36O2.C6H15N/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;1-2-3-4-5-6-7/h17H,3-16H2,1-2H3,(H,19,20);2-7H2,1H3 |
| InChIKey | HUPOOSNNNBKAAG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexylazanium;16-methylheptadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexylazanium;16-methylheptadecanoate?
The IUPAC name of hexylazanium;16-methylheptadecanoate (CID 154824431) is hexylazanium;16-methylheptadecanoate.
What is the SMILES notation for hexylazanium;16-methylheptadecanoate?
The canonical SMILES for hexylazanium;16-methylheptadecanoate is CC(C)CCCCCCCCCCCCCCC(=O)[O-].CCCCCC[NH3+].
What is the InChIKey of hexylazanium;16-methylheptadecanoate?
The InChIKey is HUPOOSNNNBKAAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C6H15N/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;1-2-3-4-5-6-7/h17H,3-16H2,1-2H3,(H,19,20);2-7H2,1H3.
What are the key properties of hexylazanium;16-methylheptadecanoate?
hexylazanium;16-methylheptadecanoate has a molecular weight of 385.68 g/mol, XLogP of 5.66, 19 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexylazanium;16-methylheptadecanoate is sourced from PubChem (CID 154824431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).