About 2-methylnonadecane;propan-2-one
2-methylnonadecane;propan-2-one (PubChem CID 141405407) has the molecular formula C23H48O
and a molecular weight of 340.64 g/mol. Its IUPAC name is 2-methylnonadecane;propan-2-one.
Molecular Properties
| Compound Name | 2-methylnonadecane;propan-2-one |
| PubChem CID | 141405407 |
| Molecular Formula | C23H48O |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.37 |
| IUPAC Name | 2-methylnonadecane;propan-2-one |
| SMILES | CC(C)=O.CCCCCCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C20H42.C3H6O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)3;1-3(2)4/h20H,4-19H2,1-3H3;1-2H3 |
| InChIKey | YENOTUFMVULKPM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylnonadecane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnonadecane;propan-2-one?
The IUPAC name of 2-methylnonadecane;propan-2-one (CID 141405407) is 2-methylnonadecane;propan-2-one.
What is the SMILES notation for 2-methylnonadecane;propan-2-one?
The canonical SMILES for 2-methylnonadecane;propan-2-one is CC(C)=O.CCCCCCCCCCCCCCCCCC(C)C.
What is the InChIKey of 2-methylnonadecane;propan-2-one?
The InChIKey is YENOTUFMVULKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42.C3H6O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)3;1-3(2)4/h20H,4-19H2,1-3H3;1-2H3.
What are the key properties of 2-methylnonadecane;propan-2-one?
2-methylnonadecane;propan-2-one has a molecular weight of 340.64 g/mol, XLogP of 8.50, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnonadecane;propan-2-one is sourced from PubChem (CID 141405407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).