About acetonitrile;2-methylheptane;propan-2-one
acetonitrile;2-methylheptane;propan-2-one (PubChem CID 174907692) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is acetonitrile;2-methylheptane;propan-2-one.
Molecular Properties
| Compound Name | acetonitrile;2-methylheptane;propan-2-one |
| PubChem CID | 174907692 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | acetonitrile;2-methylheptane;propan-2-one |
| SMILES | CC#N.CC(C)=O.CCCCCC(C)C |
| InChI | InChI=1S/C8H18.C3H6O.C2H3N/c1-4-5-6-7-8(2)3;1-3(2)4;1-2-3/h8H,4-7H2,1-3H3;1-2H3;1H3 |
| InChIKey | VHIGYVSPTWKIGN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;2-methylheptane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-methylheptane;propan-2-one?
The IUPAC name of acetonitrile;2-methylheptane;propan-2-one (CID 174907692) is acetonitrile;2-methylheptane;propan-2-one.
What is the SMILES notation for acetonitrile;2-methylheptane;propan-2-one?
The canonical SMILES for acetonitrile;2-methylheptane;propan-2-one is CC#N.CC(C)=O.CCCCCC(C)C.
What is the InChIKey of acetonitrile;2-methylheptane;propan-2-one?
The InChIKey is VHIGYVSPTWKIGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C3H6O.C2H3N/c1-4-5-6-7-8(2)3;1-3(2)4;1-2-3/h8H,4-7H2,1-3H3;1-2H3;1H3.
What are the key properties of acetonitrile;2-methylheptane;propan-2-one?
acetonitrile;2-methylheptane;propan-2-one has a molecular weight of 213.36 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-methylheptane;propan-2-one is sourced from PubChem (CID 174907692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).