About 6-methylheptanoate;rubidium(1+)
6-methylheptanoate;rubidium(1+) (PubChem CID 88757744) has the molecular formula C8H15O2Rb
and a molecular weight of 228.67 g/mol. Its IUPAC name is 6-methylheptanoate;rubidium(1+).
Molecular Properties
| Compound Name | 6-methylheptanoate;rubidium(1+) |
| PubChem CID | 88757744 |
| Molecular Formula | C8H15O2Rb |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 6-methylheptanoate;rubidium(1+) |
| SMILES | CC(C)CCCCC(=O)[O-].[Rb+] |
| InChI | InChI=1S/C8H16O2.Rb/c1-7(2)5-3-4-6-8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | IFWZGLSAEOLUTM-UHFFFAOYSA-M |
| XLogP | -2.04 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptanoate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptanoate;rubidium(1+)?
The IUPAC name of 6-methylheptanoate;rubidium(1+) (CID 88757744) is 6-methylheptanoate;rubidium(1+).
What is the SMILES notation for 6-methylheptanoate;rubidium(1+)?
The canonical SMILES for 6-methylheptanoate;rubidium(1+) is CC(C)CCCCC(=O)[O-].[Rb+].
What is the InChIKey of 6-methylheptanoate;rubidium(1+)?
The InChIKey is IFWZGLSAEOLUTM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.Rb/c1-7(2)5-3-4-6-8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1.
What are the key properties of 6-methylheptanoate;rubidium(1+)?
6-methylheptanoate;rubidium(1+) has a molecular weight of 228.67 g/mol, XLogP of -2.04, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptanoate;rubidium(1+) is sourced from PubChem (CID 88757744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).