About mercury(1+);6-methylheptanoate
mercury(1+);6-methylheptanoate (PubChem CID 175025687) has the molecular formula C8H15HgO2
and a molecular weight of 343.80 g/mol. Its IUPAC name is mercury(1+);6-methylheptanoate.
Molecular Properties
| Compound Name | mercury(1+);6-methylheptanoate |
| PubChem CID | 175025687 |
| Molecular Formula | C8H15HgO2 |
| Molecular Weight | 343.80 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | mercury(1+);6-methylheptanoate |
| SMILES | CC(C)CCCCC(=O)[O-].[Hg+] |
| InChI | InChI=1S/C8H16O2.Hg/c1-7(2)5-3-4-6-8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1 |
| InChIKey | APQIYNUNAULMOU-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.80 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze mercury(1+);6-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(1+);6-methylheptanoate?
The IUPAC name of mercury(1+);6-methylheptanoate (CID 175025687) is mercury(1+);6-methylheptanoate.
What is the SMILES notation for mercury(1+);6-methylheptanoate?
The canonical SMILES for mercury(1+);6-methylheptanoate is CC(C)CCCCC(=O)[O-].[Hg+].
What is the InChIKey of mercury(1+);6-methylheptanoate?
The InChIKey is APQIYNUNAULMOU-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.Hg/c1-7(2)5-3-4-6-8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+1/p-1.
What are the key properties of mercury(1+);6-methylheptanoate?
mercury(1+);6-methylheptanoate has a molecular weight of 343.80 g/mol, XLogP of 0.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(1+);6-methylheptanoate is sourced from PubChem (CID 175025687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).