About sodium 5-methylhexanoate
sodium 5-methylhexanoate (PubChem CID 58914873) has the molecular formula C7H13NaO2
and a molecular weight of 152.17 g/mol. Its IUPAC name is sodium 5-methylhexanoate.
Molecular Properties
| Compound Name | sodium 5-methylhexanoate |
| PubChem CID | 58914873 |
| Molecular Formula | C7H13NaO2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | sodium 5-methylhexanoate |
| SMILES | CC(C)CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H14O2.Na/c1-6(2)4-3-5-7(8)9;/h6H,3-5H2,1-2H3,(H,8,9);/q;+1/p-1 |
| InChIKey | YHDTYWLKYFVOKH-UHFFFAOYSA-M |
| XLogP | -2.43 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-methylhexanoate?
The IUPAC name of sodium 5-methylhexanoate (CID 58914873) is sodium 5-methylhexanoate.
What is the SMILES notation for sodium 5-methylhexanoate?
The canonical SMILES for sodium 5-methylhexanoate is CC(C)CCCC(=O)[O-].[Na+].
What is the InChIKey of sodium 5-methylhexanoate?
The InChIKey is YHDTYWLKYFVOKH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14O2.Na/c1-6(2)4-3-5-7(8)9;/h6H,3-5H2,1-2H3,(H,8,9);/q;+1/p-1.
What are the key properties of sodium 5-methylhexanoate?
sodium 5-methylhexanoate has a molecular weight of 152.17 g/mol, XLogP of -2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-methylhexanoate is sourced from PubChem (CID 58914873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).