About 6-methyl-2-oxoheptanoate
6-methyl-2-oxoheptanoate (PubChem CID 152759081) has the molecular formula C8H13O3-
and a molecular weight of 157.19 g/mol. Its IUPAC name is 6-methyl-2-oxoheptanoate.
Molecular Properties
| Compound Name | 6-methyl-2-oxoheptanoate |
| PubChem CID | 152759081 |
| Molecular Formula | C8H13O3- |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 6-methyl-2-oxoheptanoate |
| SMILES | CC(C)CCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C8H14O3/c1-6(2)4-3-5-7(9)8(10)11/h6H,3-5H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | UKFYEQPRZKSNON-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-oxoheptanoate?
The IUPAC name of 6-methyl-2-oxoheptanoate (CID 152759081) is 6-methyl-2-oxoheptanoate.
What is the SMILES notation for 6-methyl-2-oxoheptanoate?
The canonical SMILES for 6-methyl-2-oxoheptanoate is CC(C)CCCC(=O)C(=O)[O-].
What is the InChIKey of 6-methyl-2-oxoheptanoate?
The InChIKey is UKFYEQPRZKSNON-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14O3/c1-6(2)4-3-5-7(9)8(10)11/h6H,3-5H2,1-2H3,(H,10,11)/p-1.
What are the key properties of 6-methyl-2-oxoheptanoate?
6-methyl-2-oxoheptanoate has a molecular weight of 157.19 g/mol, XLogP of 0.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-oxoheptanoate is sourced from PubChem (CID 152759081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).