About copper(1+);4-methylpentanoate
copper(1+);4-methylpentanoate (PubChem CID 159345928) has the molecular formula C6H11CuO2
and a molecular weight of 178.70 g/mol. Its IUPAC name is copper(1+);4-methylpentanoate.
Molecular Properties
| Compound Name | copper(1+);4-methylpentanoate |
| PubChem CID | 159345928 |
| Molecular Formula | C6H11CuO2 |
| Molecular Weight | 178.70 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | copper(1+);4-methylpentanoate |
| SMILES | CC(C)CCC(=O)[O-].[Cu+] |
| InChI | InChI=1S/C6H12O2.Cu/c1-5(2)3-4-6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1 |
| InChIKey | LGSLKMDUKJEFEH-UHFFFAOYSA-M |
| XLogP | 0.17 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.70 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper(1+);4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);4-methylpentanoate?
The IUPAC name of copper(1+);4-methylpentanoate (CID 159345928) is copper(1+);4-methylpentanoate.
What is the SMILES notation for copper(1+);4-methylpentanoate?
The canonical SMILES for copper(1+);4-methylpentanoate is CC(C)CCC(=O)[O-].[Cu+].
What is the InChIKey of copper(1+);4-methylpentanoate?
The InChIKey is LGSLKMDUKJEFEH-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O2.Cu/c1-5(2)3-4-6(7)8;/h5H,3-4H2,1-2H3,(H,7,8);/q;+1/p-1.
What are the key properties of copper(1+);4-methylpentanoate?
copper(1+);4-methylpentanoate has a molecular weight of 178.70 g/mol, XLogP of 0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);4-methylpentanoate is sourced from PubChem (CID 159345928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).