About 4-bromopentanoate
4-bromopentanoate (PubChem CID 19430630) has the molecular formula C5H8BrO2-
and a molecular weight of 180.02 g/mol. Its IUPAC name is 4-bromopentanoate.
Molecular Properties
| Compound Name | 4-bromopentanoate |
| PubChem CID | 19430630 |
| Molecular Formula | C5H8BrO2- |
| Molecular Weight | 180.02 g/mol |
| Exact Mass | 178.97 |
| IUPAC Name | 4-bromopentanoate |
| SMILES | CC(Br)CCC(=O)[O-] |
| InChI | InChI=1S/C5H9BrO2/c1-4(6)2-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)/p-1 |
| InChIKey | XILQGXZARXHSEI-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.02 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromopentanoate?
The IUPAC name of 4-bromopentanoate (CID 19430630) is 4-bromopentanoate.
What is the SMILES notation for 4-bromopentanoate?
The canonical SMILES for 4-bromopentanoate is CC(Br)CCC(=O)[O-].
What is the InChIKey of 4-bromopentanoate?
The InChIKey is XILQGXZARXHSEI-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H9BrO2/c1-4(6)2-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)/p-1.
What are the key properties of 4-bromopentanoate?
4-bromopentanoate has a molecular weight of 180.02 g/mol, XLogP of 0.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromopentanoate is sourced from PubChem (CID 19430630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).