C6H12FNO2 — CID 71717308
(4S,5R)-4-azaniumyl-5-fluorohexanoate (PubChem CID 71717308) has the molecular formula C6H12FNO2 and a molecular weight of 149.16 g/mol. Its IUPAC name is (4S,5R)-4-azaniumyl-5-fluorohexanoate.
| Compound Name | (4S,5R)-4-azaniumyl-5-fluorohexanoate |
|---|---|
| PubChem CID | 71717308 |
| Molecular Formula | C6H12FNO2 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | (4S,5R)-4-azaniumyl-5-fluorohexanoate |
| SMILES | C[C@@H](F)[C@@H]([NH3+])CCC(=O)[O-] |
| InChI | InChI=1S/C6H12FNO2/c1-4(7)5(8)2-3-6(9)10/h4-5H,2-3,8H2,1H3,(H,9,10)/t4-,5+/m1/s1 |
| InChIKey | BRMXCZLHKCLKIJ-UHNVWZDZSA-N |
| XLogP | -1.51 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |