C10H12NO9-3 — CID 158602058
2-azaniumylpentanedioate;2-oxopentanedioate (PubChem CID 158602058) has the molecular formula C10H12NO9-3 and a molecular weight of 290.20 g/mol. Its IUPAC name is 2-azaniumylpentanedioate;2-oxopentanedioate.
| Compound Name | 2-azaniumylpentanedioate;2-oxopentanedioate |
|---|---|
| PubChem CID | 158602058 |
| Molecular Formula | C10H12NO9-3 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-azaniumylpentanedioate;2-oxopentanedioate |
| SMILES | O=C([O-])CCC(=O)C(=O)[O-].[NH3+]C(CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H9NO4.C5H6O5/c2*6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10);1-2H2,(H,7,8)(H,9,10)/p-3 |
| InChIKey | HVTHWFHGYGPDLC-UHFFFAOYSA-K |
| XLogP | -7.29 |
| TPSA | 205.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | -7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|