About zinc 2-oxopentanedioate
zinc 2-oxopentanedioate (PubChem CID 10236089) has the molecular formula C5H4O5Zn
and a molecular weight of 209.47 g/mol. Its IUPAC name is zinc 2-oxopentanedioate.
Molecular Properties
| Compound Name | zinc 2-oxopentanedioate |
| PubChem CID | 10236089 |
| Molecular Formula | C5H4O5Zn |
| Molecular Weight | 209.47 g/mol |
| Exact Mass | 207.94 |
| IUPAC Name | zinc 2-oxopentanedioate |
| SMILES | O=C([O-])CCC(=O)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C5H6O5.Zn/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | GYBLQYIEAGSJPW-UHFFFAOYSA-L |
| XLogP | -3.17 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.47 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc 2-oxopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc 2-oxopentanedioate?
The IUPAC name of zinc 2-oxopentanedioate (CID 10236089) is zinc 2-oxopentanedioate.
What is the SMILES notation for zinc 2-oxopentanedioate?
The canonical SMILES for zinc 2-oxopentanedioate is O=C([O-])CCC(=O)C(=O)[O-].[Zn+2].
What is the InChIKey of zinc 2-oxopentanedioate?
The InChIKey is GYBLQYIEAGSJPW-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H6O5.Zn/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+2/p-2.
What are the key properties of zinc 2-oxopentanedioate?
zinc 2-oxopentanedioate has a molecular weight of 209.47 g/mol, XLogP of -3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for zinc 2-oxopentanedioate is sourced from PubChem (CID 10236089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).